C7H6BrNO2 — CID 136574209
7-bromo-1,3-benzodioxol-5-amine (PubChem CID 136574209) has the molecular formula C7H6BrNO2 and a molecular weight of 216.03 g/mol. Its IUPAC name is 7-bromo-1,3-benzodioxol-5-amine.
| Compound Name | 7-bromo-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 136574209 |
| Molecular Formula | C7H6BrNO2 |
| Molecular Weight | 216.03 g/mol |
| Exact Mass | 214.96 |
| IUPAC Name | 7-bromo-1,3-benzodioxol-5-amine |
| SMILES | Nc1cc(Br)c2c(c1)OCO2 |
| InChI | InChI=1S/C7H6BrNO2/c8-5-1-4(9)2-6-7(5)11-3-10-6/h1-2H,3,9H2 |
| InChIKey | GQPBQVSWORUNAS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.03 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|