C11H14BrNO3 — CID 43566109
2-amino-1-(7-bromo-1,3-benzodioxol-5-yl)butan-1-ol (PubChem CID 43566109) has the molecular formula C11H14BrNO3 and a molecular weight of 288.14 g/mol. Its IUPAC name is 2-amino-1-(7-bromo-1,3-benzodioxol-5-yl)butan-1-ol.
| Compound Name | 2-amino-1-(7-bromo-1,3-benzodioxol-5-yl)butan-1-ol |
|---|---|
| PubChem CID | 43566109 |
| Molecular Formula | C11H14BrNO3 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 2-amino-1-(7-bromo-1,3-benzodioxol-5-yl)butan-1-ol |
| SMILES | CCC(N)C(O)c1cc(Br)c2c(c1)OCO2 |
| InChI | InChI=1S/C11H14BrNO3/c1-2-8(13)10(14)6-3-7(12)11-9(4-6)15-5-16-11/h3-4,8,10,14H,2,5,13H2,1H3 |
| InChIKey | SIYOZQPMJZEGQG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |