C15H19BrO3 — CID 64749374
(7-bromo-1,3-benzodioxol-5-yl)-(4-methylcyclohexyl)methanol (PubChem CID 64749374) has the molecular formula C15H19BrO3 and a molecular weight of 327.22 g/mol. Its IUPAC name is (7-bromo-1,3-benzodioxol-5-yl)-(4-methylcyclohexyl)methanol.
| Compound Name | (7-bromo-1,3-benzodioxol-5-yl)-(4-methylcyclohexyl)methanol |
|---|---|
| PubChem CID | 64749374 |
| Molecular Formula | C15H19BrO3 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | (7-bromo-1,3-benzodioxol-5-yl)-(4-methylcyclohexyl)methanol |
| SMILES | CC1CCC(C(O)c2cc(Br)c3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C15H19BrO3/c1-9-2-4-10(5-3-9)14(17)11-6-12(16)15-13(7-11)18-8-19-15/h6-7,9-10,14,17H,2-5,8H2,1H3 |
| InChIKey | LCDJVXQFJFBSJC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |