About 1-(7-bromo-1,3-benzodioxol-5-yl)-2-(3,4-dimethylphenyl)ethanol
1-(7-bromo-1,3-benzodioxol-5-yl)-2-(3,4-dimethylphenyl)ethanol (PubChem CID 63893287) has the molecular formula C17H17BrO3
and a molecular weight of 349.22 g/mol. Its IUPAC name is 1-(7-bromo-1,3-benzodioxol-5-yl)-2-(3,4-dimethylphenyl)ethanol.
Molecular Properties
| Compound Name | 1-(7-bromo-1,3-benzodioxol-5-yl)-2-(3,4-dimethylphenyl)ethanol |
| PubChem CID | 63893287 |
| Molecular Formula | C17H17BrO3 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 1-(7-bromo-1,3-benzodioxol-5-yl)-2-(3,4-dimethylphenyl)ethanol |
| SMILES | Cc1ccc(CC(O)c2cc(Br)c3c(c2)OCO3)cc1C |
| InChI | InChI=1S/C17H17BrO3/c1-10-3-4-12(5-11(10)2)6-15(19)13-7-14(18)17-16(8-13)20-9-21-17/h3-5,7-8,15,19H,6,9H2,1-2H3 |
| InChIKey | CVNRTRUGIQWSQS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(7-bromo-1,3-benzodioxol-5-yl)-2-(3,4-dimethylphenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-bromo-1,3-benzodioxol-5-yl)-2-(3,4-dimethylphenyl)ethanol?
The IUPAC name of 1-(7-bromo-1,3-benzodioxol-5-yl)-2-(3,4-dimethylphenyl)ethanol (CID 63893287) is 1-(7-bromo-1,3-benzodioxol-5-yl)-2-(3,4-dimethylphenyl)ethanol.
What is the SMILES notation for 1-(7-bromo-1,3-benzodioxol-5-yl)-2-(3,4-dimethylphenyl)ethanol?
The canonical SMILES for 1-(7-bromo-1,3-benzodioxol-5-yl)-2-(3,4-dimethylphenyl)ethanol is Cc1ccc(CC(O)c2cc(Br)c3c(c2)OCO3)cc1C.
What is the InChIKey of 1-(7-bromo-1,3-benzodioxol-5-yl)-2-(3,4-dimethylphenyl)ethanol?
The InChIKey is CVNRTRUGIQWSQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17BrO3/c1-10-3-4-12(5-11(10)2)6-15(19)13-7-14(18)17-16(8-13)20-9-21-17/h3-5,7-8,15,19H,6,9H2,1-2H3.
What are the key properties of 1-(7-bromo-1,3-benzodioxol-5-yl)-2-(3,4-dimethylphenyl)ethanol?
1-(7-bromo-1,3-benzodioxol-5-yl)-2-(3,4-dimethylphenyl)ethanol has a molecular weight of 349.22 g/mol, XLogP of 4.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-bromo-1,3-benzodioxol-5-yl)-2-(3,4-dimethylphenyl)ethanol is sourced from PubChem (CID 63893287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).