C15H12BrClO3 — CID 63895393
1-(7-bromo-1,3-benzodioxol-5-yl)-2-(3-chlorophenyl)ethanol (PubChem CID 63895393) has the molecular formula C15H12BrClO3 and a molecular weight of 355.62 g/mol. Its IUPAC name is 1-(7-bromo-1,3-benzodioxol-5-yl)-2-(3-chlorophenyl)ethanol.
| Compound Name | 1-(7-bromo-1,3-benzodioxol-5-yl)-2-(3-chlorophenyl)ethanol |
|---|---|
| PubChem CID | 63895393 |
| Molecular Formula | C15H12BrClO3 |
| Molecular Weight | 355.62 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | 1-(7-bromo-1,3-benzodioxol-5-yl)-2-(3-chlorophenyl)ethanol |
| SMILES | OC(Cc1cccc(Cl)c1)c1cc(Br)c2c(c1)OCO2 |
| InChI | InChI=1S/C15H12BrClO3/c16-12-6-10(7-14-15(12)20-8-19-14)13(18)5-9-2-1-3-11(17)4-9/h1-4,6-7,13,18H,5,8H2 |
| InChIKey | HXILNCAENWCIKH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.62 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |