C14H11Br2ClO — CID 107978121
2-(3-chlorophenyl)-1-(3,5-dibromophenyl)ethanol (PubChem CID 107978121) has the molecular formula C14H11Br2ClO and a molecular weight of 390.50 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-(3,5-dibromophenyl)ethanol.
| Compound Name | 2-(3-chlorophenyl)-1-(3,5-dibromophenyl)ethanol |
|---|---|
| PubChem CID | 107978121 |
| Molecular Formula | C14H11Br2ClO |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 387.89 |
| IUPAC Name | 2-(3-chlorophenyl)-1-(3,5-dibromophenyl)ethanol |
| SMILES | OC(Cc1cccc(Cl)c1)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C14H11Br2ClO/c15-11-6-10(7-12(16)8-11)14(18)5-9-2-1-3-13(17)4-9/h1-4,6-8,14,18H,5H2 |
| InChIKey | CZJZOVNGMBCLHH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |