C14H11ClF2O — CID 60797621
2-(3-chlorophenyl)-1-(3,4-difluorophenyl)ethanol (PubChem CID 60797621) has the molecular formula C14H11ClF2O and a molecular weight of 268.69 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-(3,4-difluorophenyl)ethanol.
| Compound Name | 2-(3-chlorophenyl)-1-(3,4-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 60797621 |
| Molecular Formula | C14H11ClF2O |
| Molecular Weight | 268.69 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-(3-chlorophenyl)-1-(3,4-difluorophenyl)ethanol |
| SMILES | OC(Cc1cccc(Cl)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H11ClF2O/c15-11-3-1-2-9(6-11)7-14(18)10-4-5-12(16)13(17)8-10/h1-6,8,14,18H,7H2 |
| InChIKey | BQQFRIQLOIHEDX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.69 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |