C14H10BrClF2O — CID 82919458
1-(3-bromo-4-chlorophenyl)-2-(3,4-difluorophenyl)ethanol (PubChem CID 82919458) has the molecular formula C14H10BrClF2O and a molecular weight of 347.59 g/mol. Its IUPAC name is 1-(3-bromo-4-chlorophenyl)-2-(3,4-difluorophenyl)ethanol.
| Compound Name | 1-(3-bromo-4-chlorophenyl)-2-(3,4-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 82919458 |
| Molecular Formula | C14H10BrClF2O |
| Molecular Weight | 347.59 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | 1-(3-bromo-4-chlorophenyl)-2-(3,4-difluorophenyl)ethanol |
| SMILES | OC(Cc1ccc(F)c(F)c1)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C14H10BrClF2O/c15-10-7-9(2-3-11(10)16)14(19)6-8-1-4-12(17)13(18)5-8/h1-5,7,14,19H,6H2 |
| InChIKey | VTFOSWLRZGBFAS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |