C14H10Cl2F2O — CID 62607593
2-(3,4-dichlorophenyl)-1-(3,4-difluorophenyl)ethanol (PubChem CID 62607593) has the molecular formula C14H10Cl2F2O and a molecular weight of 303.14 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-(3,4-difluorophenyl)ethanol.
| Compound Name | 2-(3,4-dichlorophenyl)-1-(3,4-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 62607593 |
| Molecular Formula | C14H10Cl2F2O |
| Molecular Weight | 303.14 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-(3,4-difluorophenyl)ethanol |
| SMILES | OC(Cc1ccc(Cl)c(Cl)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H10Cl2F2O/c15-10-3-1-8(5-11(10)16)6-14(19)9-2-4-12(17)13(18)7-9/h1-5,7,14,19H,6H2 |
| InChIKey | KMOGTBHVKYUITK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.14 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |