C18H20Cl2O — CID 115482625
2-(3,4-dichlorophenyl)-1-(3,4-diethylphenyl)ethanol (PubChem CID 115482625) has the molecular formula C18H20Cl2O and a molecular weight of 323.26 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-(3,4-diethylphenyl)ethanol.
| Compound Name | 2-(3,4-dichlorophenyl)-1-(3,4-diethylphenyl)ethanol |
|---|---|
| PubChem CID | 115482625 |
| Molecular Formula | C18H20Cl2O |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-(3,4-diethylphenyl)ethanol |
| SMILES | CCc1ccc(C(O)Cc2ccc(Cl)c(Cl)c2)cc1CC |
| InChI | InChI=1S/C18H20Cl2O/c1-3-13-6-7-15(11-14(13)4-2)18(21)10-12-5-8-16(19)17(20)9-12/h5-9,11,18,21H,3-4,10H2,1-2H3 |
| InChIKey | VCYMZOKPMAZNBR-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |