C15H11Cl2NO3 — CID 63047192
6-[2-(3,4-dichlorophenyl)-1-hydroxyethyl]-3H-1,3-benzoxazol-2-one (PubChem CID 63047192) has the molecular formula C15H11Cl2NO3 and a molecular weight of 324.16 g/mol. Its IUPAC name is 6-[2-(3,4-dichlorophenyl)-1-hydroxyethyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[2-(3,4-dichlorophenyl)-1-hydroxyethyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 63047192 |
| Molecular Formula | C15H11Cl2NO3 |
| Molecular Weight | 324.16 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 6-[2-(3,4-dichlorophenyl)-1-hydroxyethyl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2ccc(C(O)Cc3ccc(Cl)c(Cl)c3)cc2o1 |
| InChI | InChI=1S/C15H11Cl2NO3/c16-10-3-1-8(5-11(10)17)6-13(19)9-2-4-12-14(7-9)21-15(20)18-12/h1-5,7,13,19H,6H2,(H,18,20) |
| InChIKey | UPLITSWXEYTJPD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.16 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |