C14H9Cl2N3O3 — CID 155113953
1-(3,4-dichlorophenyl)-3-(2-oxo-3H-1,3-benzoxazol-6-yl)urea (PubChem CID 155113953) has the molecular formula C14H9Cl2N3O3 and a molecular weight of 338.15 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(2-oxo-3H-1,3-benzoxazol-6-yl)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(2-oxo-3H-1,3-benzoxazol-6-yl)urea |
|---|---|
| PubChem CID | 155113953 |
| Molecular Formula | C14H9Cl2N3O3 |
| Molecular Weight | 338.15 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(2-oxo-3H-1,3-benzoxazol-6-yl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nc1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C14H9Cl2N3O3/c15-9-3-1-7(5-10(9)16)17-13(20)18-8-2-4-11-12(6-8)22-14(21)19-11/h1-6H,(H,19,21)(H2,17,18,20) |
| InChIKey | ROSGCGUOELPMIS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.15 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |