C15H13N3O3 — CID 110411881
1-benzyl-3-(2-oxo-3H-1,3-benzoxazol-6-yl)urea (PubChem CID 110411881) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is 1-benzyl-3-(2-oxo-3H-1,3-benzoxazol-6-yl)urea.
| Compound Name | 1-benzyl-3-(2-oxo-3H-1,3-benzoxazol-6-yl)urea |
|---|---|
| PubChem CID | 110411881 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 1-benzyl-3-(2-oxo-3H-1,3-benzoxazol-6-yl)urea |
| SMILES | O=C(NCc1ccccc1)Nc1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C15H13N3O3/c19-14(16-9-10-4-2-1-3-5-10)17-11-6-7-12-13(8-11)21-15(20)18-12/h1-8H,9H2,(H,18,20)(H2,16,17,19) |
| InChIKey | YDMVUCKPSSUVSP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |