C14H11N3O2S — CID 34883375
1-(2-oxo-3H-1,3-benzoxazol-6-yl)-3-phenylthiourea (PubChem CID 34883375) has the molecular formula C14H11N3O2S and a molecular weight of 285.33 g/mol. Its IUPAC name is 1-(2-oxo-3H-1,3-benzoxazol-6-yl)-3-phenylthiourea.
| Compound Name | 1-(2-oxo-3H-1,3-benzoxazol-6-yl)-3-phenylthiourea |
|---|---|
| PubChem CID | 34883375 |
| Molecular Formula | C14H11N3O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 1-(2-oxo-3H-1,3-benzoxazol-6-yl)-3-phenylthiourea |
| SMILES | O=c1[nH]c2ccc(NC(=S)Nc3ccccc3)cc2o1 |
| InChI | InChI=1S/C14H11N3O2S/c18-14-17-11-7-6-10(8-12(11)19-14)16-13(20)15-9-4-2-1-3-5-9/h1-8H,(H,17,18)(H2,15,16,20) |
| InChIKey | RFTWRUKHCBCKOU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|