C10H9ClN2O3 — CID 11543243
3-chloro-N-(2-oxo-3H-1,3-benzoxazol-6-yl)propanamide (PubChem CID 11543243) has the molecular formula C10H9ClN2O3 and a molecular weight of 240.65 g/mol. Its IUPAC name is 3-chloro-N-(2-oxo-3H-1,3-benzoxazol-6-yl)propanamide.
| Compound Name | 3-chloro-N-(2-oxo-3H-1,3-benzoxazol-6-yl)propanamide |
|---|---|
| PubChem CID | 11543243 |
| Molecular Formula | C10H9ClN2O3 |
| Molecular Weight | 240.65 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 3-chloro-N-(2-oxo-3H-1,3-benzoxazol-6-yl)propanamide |
| SMILES | O=C(CCCl)Nc1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C10H9ClN2O3/c11-4-3-9(14)12-6-1-2-7-8(5-6)16-10(15)13-7/h1-2,5H,3-4H2,(H,12,14)(H,13,15) |
| InChIKey | ZBNIKKFXWNEWLH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 75.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.65 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|