C12H12N2O5 — CID 110662078
methyl 4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-6-yl)amino]butanoate (PubChem CID 110662078) has the molecular formula C12H12N2O5 and a molecular weight of 264.24 g/mol. Its IUPAC name is methyl 4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-6-yl)amino]butanoate.
| Compound Name | methyl 4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-6-yl)amino]butanoate |
|---|---|
| PubChem CID | 110662078 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | methyl 4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-6-yl)amino]butanoate |
| SMILES | COC(=O)CCC(=O)Nc1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C12H12N2O5/c1-18-11(16)5-4-10(15)13-7-2-3-8-9(6-7)19-12(17)14-8/h2-3,6H,4-5H2,1H3,(H,13,15)(H,14,17) |
| InChIKey | HQNNUQMNFXWTGQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |