C18H15FN2O4 — CID 110616402
5-(4-fluorophenyl)-5-oxo-N-(2-oxo-3H-1,3-benzoxazol-6-yl)pentanamide (PubChem CID 110616402) has the molecular formula C18H15FN2O4 and a molecular weight of 342.33 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-5-oxo-N-(2-oxo-3H-1,3-benzoxazol-6-yl)pentanamide.
| Compound Name | 5-(4-fluorophenyl)-5-oxo-N-(2-oxo-3H-1,3-benzoxazol-6-yl)pentanamide |
|---|---|
| PubChem CID | 110616402 |
| Molecular Formula | C18H15FN2O4 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 5-(4-fluorophenyl)-5-oxo-N-(2-oxo-3H-1,3-benzoxazol-6-yl)pentanamide |
| SMILES | O=C(CCCC(=O)c1ccc(F)cc1)Nc1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C18H15FN2O4/c19-12-6-4-11(5-7-12)15(22)2-1-3-17(23)20-13-8-9-14-16(10-13)25-18(24)21-14/h4-10H,1-3H2,(H,20,23)(H,21,24) |
| InChIKey | GTONWSRVIMKKHN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |