C9H8N2O4 — CID 83820376
2-hydroxy-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide (PubChem CID 83820376) has the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. Its IUPAC name is 2-hydroxy-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide.
| Compound Name | 2-hydroxy-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide |
|---|---|
| PubChem CID | 83820376 |
| Molecular Formula | C9H8N2O4 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 2-hydroxy-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide |
| SMILES | O=C(CO)Nc1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C9H8N2O4/c12-4-8(13)10-5-1-2-6-7(3-5)15-9(14)11-6/h1-3,12H,4H2,(H,10,13)(H,11,14) |
| InChIKey | PJTDRWZIBYNONY-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |