C9H8N2O3S — CID 115166967
N-(2-oxo-3H-1,3-benzoxazol-6-yl)-2-sulfanylacetamide (PubChem CID 115166967) has the molecular formula C9H8N2O3S and a molecular weight of 224.24 g/mol. Its IUPAC name is N-(2-oxo-3H-1,3-benzoxazol-6-yl)-2-sulfanylacetamide.
| Compound Name | N-(2-oxo-3H-1,3-benzoxazol-6-yl)-2-sulfanylacetamide |
|---|---|
| PubChem CID | 115166967 |
| Molecular Formula | C9H8N2O3S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | N-(2-oxo-3H-1,3-benzoxazol-6-yl)-2-sulfanylacetamide |
| SMILES | O=C(CS)Nc1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C9H8N2O3S/c12-8(4-15)10-5-1-2-6-7(3-5)14-9(13)11-6/h1-3,15H,4H2,(H,10,12)(H,11,13) |
| InChIKey | YAPVIYRFYXNMKY-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 75.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|