C11H10N2O5 — CID 53304199
ethyl 2-oxo-2-[(2-oxo-3H-1,3-benzoxazol-6-yl)amino]acetate (PubChem CID 53304199) has the molecular formula C11H10N2O5 and a molecular weight of 250.21 g/mol. Its IUPAC name is ethyl 2-oxo-2-[(2-oxo-3H-1,3-benzoxazol-6-yl)amino]acetate.
| Compound Name | ethyl 2-oxo-2-[(2-oxo-3H-1,3-benzoxazol-6-yl)amino]acetate |
|---|---|
| PubChem CID | 53304199 |
| Molecular Formula | C11H10N2O5 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | ethyl 2-oxo-2-[(2-oxo-3H-1,3-benzoxazol-6-yl)amino]acetate |
| SMILES | CCOC(=O)C(=O)Nc1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C11H10N2O5/c1-2-17-10(15)9(14)12-6-3-4-7-8(5-6)18-11(16)13-7/h3-5H,2H2,1H3,(H,12,14)(H,13,16) |
| InChIKey | WPXDIQHMSNXANF-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|