C10H9N3O5 — CID 115179135
2-amino-3-oxo-3-[(2-oxo-3H-1,3-benzoxazol-6-yl)amino]propanoic acid (PubChem CID 115179135) has the molecular formula C10H9N3O5 and a molecular weight of 251.20 g/mol. Its IUPAC name is 2-amino-3-oxo-3-[(2-oxo-3H-1,3-benzoxazol-6-yl)amino]propanoic acid.
| Compound Name | 2-amino-3-oxo-3-[(2-oxo-3H-1,3-benzoxazol-6-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 115179135 |
| Molecular Formula | C10H9N3O5 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 2-amino-3-oxo-3-[(2-oxo-3H-1,3-benzoxazol-6-yl)amino]propanoic acid |
| SMILES | NC(C(=O)O)C(=O)Nc1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C10H9N3O5/c11-7(9(15)16)8(14)12-4-1-2-5-6(3-4)18-10(17)13-5/h1-3,7H,11H2,(H,12,14)(H,13,17)(H,15,16) |
| InChIKey | HTQBBROHBXPCFX-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 138.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|