C18H17FN2O3 — CID 110619565
2-(4-fluorophenyl)-3-methyl-N-(2-oxo-3H-1,3-benzoxazol-6-yl)butanamide (PubChem CID 110619565) has the molecular formula C18H17FN2O3 and a molecular weight of 328.34 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3-methyl-N-(2-oxo-3H-1,3-benzoxazol-6-yl)butanamide.
| Compound Name | 2-(4-fluorophenyl)-3-methyl-N-(2-oxo-3H-1,3-benzoxazol-6-yl)butanamide |
|---|---|
| PubChem CID | 110619565 |
| Molecular Formula | C18H17FN2O3 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-(4-fluorophenyl)-3-methyl-N-(2-oxo-3H-1,3-benzoxazol-6-yl)butanamide |
| SMILES | CC(C)C(C(=O)Nc1ccc2[nH]c(=O)oc2c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H17FN2O3/c1-10(2)16(11-3-5-12(19)6-4-11)17(22)20-13-7-8-14-15(9-13)24-18(23)21-14/h3-10,16H,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | WGNWPJLBHSPVEL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 75.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |