C10H11N3O3 — CID 115169173
1-methyl-3-[(2-oxo-3H-1,3-benzoxazol-6-yl)methyl]urea (PubChem CID 115169173) has the molecular formula C10H11N3O3 and a molecular weight of 221.22 g/mol. Its IUPAC name is 1-methyl-3-[(2-oxo-3H-1,3-benzoxazol-6-yl)methyl]urea.
| Compound Name | 1-methyl-3-[(2-oxo-3H-1,3-benzoxazol-6-yl)methyl]urea |
|---|---|
| PubChem CID | 115169173 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 1-methyl-3-[(2-oxo-3H-1,3-benzoxazol-6-yl)methyl]urea |
| SMILES | CNC(=O)NCc1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C10H11N3O3/c1-11-9(14)12-5-6-2-3-7-8(4-6)16-10(15)13-7/h2-4H,5H2,1H3,(H,13,15)(H2,11,12,14) |
| InChIKey | UQPNYICPEBBDNN-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |