C11H13N3O3 — CID 115169282
1,3-dimethyl-1-[(2-oxo-3H-1,3-benzoxazol-6-yl)methyl]urea (PubChem CID 115169282) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 1,3-dimethyl-1-[(2-oxo-3H-1,3-benzoxazol-6-yl)methyl]urea.
| Compound Name | 1,3-dimethyl-1-[(2-oxo-3H-1,3-benzoxazol-6-yl)methyl]urea |
|---|---|
| PubChem CID | 115169282 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 1,3-dimethyl-1-[(2-oxo-3H-1,3-benzoxazol-6-yl)methyl]urea |
| SMILES | CNC(=O)N(C)Cc1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C11H13N3O3/c1-12-10(15)14(2)6-7-3-4-8-9(5-7)17-11(16)13-8/h3-5H,6H2,1-2H3,(H,12,15)(H,13,16) |
| InChIKey | JGLGMYBULDARNE-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |