C11H13N3O2 — CID 115169274
1-(1,3-benzoxazol-6-ylmethyl)-1,3-dimethylurea (PubChem CID 115169274) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-6-ylmethyl)-1,3-dimethylurea.
| Compound Name | 1-(1,3-benzoxazol-6-ylmethyl)-1,3-dimethylurea |
|---|---|
| PubChem CID | 115169274 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 1-(1,3-benzoxazol-6-ylmethyl)-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)Cc1ccc2ncoc2c1 |
| InChI | InChI=1S/C11H13N3O2/c1-12-11(15)14(2)6-8-3-4-9-10(5-8)16-7-13-9/h3-5,7H,6H2,1-2H3,(H,12,15) |
| InChIKey | IZYVUESTHJLKBY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |