3-amino-4-[1,3-benzoxazol-6-ylmethyl(methyl)amino]butanoic acid

C13H17N3O3 — CID 115241766

IUPAC3-amino-4-[1,3-benzoxazol-6-ylmethyl(methyl)amino]butanoic acid
SMILESCN(Cc1ccc2ncoc2c1)CC(N)CC(=O)O
InChIInChI=1S/C13H17N3O3/c1-16(7-10(14)5-13(17)18)6-9-2-3-11-12(4-9)19-8-15-11/h2-4,8,10H,5-7,14H2,1H3,(H,17,18)
InChIKeyBPMPAJMJDAWZCT-UHFFFAOYSA-N
MW263.30 g/mol
LogP1.06
Rot. Bonds6

About 3-amino-4-[1,3-benzoxazol-6-ylmethyl(methyl)amino]butanoic acid

3-amino-4-[1,3-benzoxazol-6-ylmethyl(methyl)amino]butanoic acid (PubChem CID 115241766) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 3-amino-4-[1,3-benzoxazol-6-ylmethyl(methyl)amino]butanoic acid.

Molecular Properties

Compound Name3-amino-4-[1,3-benzoxazol-6-ylmethyl(methyl)amino]butanoic acid
PubChem CID115241766
Molecular FormulaC13H17N3O3
Molecular Weight263.30 g/mol
Exact Mass263.13
IUPAC Name3-amino-4-[1,3-benzoxazol-6-ylmethyl(methyl)amino]butanoic acid
SMILESCN(Cc1ccc2ncoc2c1)CC(N)CC(=O)O
InChIInChI=1S/C13H17N3O3/c1-16(7-10(14)5-13(17)18)6-9-2-3-11-12(4-9)19-8-15-11/h2-4,8,10H,5-7,14H2,1H3,(H,17,18)
InChIKeyBPMPAJMJDAWZCT-UHFFFAOYSA-N
XLogP1.06
TPSA92.59 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.30
LogP ≤ 51.06
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 3-amino-4-[1,3-benzoxazol-6-ylmethyl(methyl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-4-[1,3-benzoxazol-6-ylmethyl(methyl)amino]butanoic acid?
The IUPAC name of 3-amino-4-[1,3-benzoxazol-6-ylmethyl(methyl)amino]butanoic acid (CID 115241766) is 3-amino-4-[1,3-benzoxazol-6-ylmethyl(methyl)amino]butanoic acid.
What is the SMILES notation for 3-amino-4-[1,3-benzoxazol-6-ylmethyl(methyl)amino]butanoic acid?
The canonical SMILES for 3-amino-4-[1,3-benzoxazol-6-ylmethyl(methyl)amino]butanoic acid is CN(Cc1ccc2ncoc2c1)CC(N)CC(=O)O.
What is the InChIKey of 3-amino-4-[1,3-benzoxazol-6-ylmethyl(methyl)amino]butanoic acid?
The InChIKey is BPMPAJMJDAWZCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O3/c1-16(7-10(14)5-13(17)18)6-9-2-3-11-12(4-9)19-8-15-11/h2-4,8,10H,5-7,14H2,1H3,(H,17,18).
What are the key properties of 3-amino-4-[1,3-benzoxazol-6-ylmethyl(methyl)amino]butanoic acid?
3-amino-4-[1,3-benzoxazol-6-ylmethyl(methyl)amino]butanoic acid has a molecular weight of 263.30 g/mol, XLogP of 1.06, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-[1,3-benzoxazol-6-ylmethyl(methyl)amino]butanoic acid is sourced from PubChem (CID 115241766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).