C12H14N2O3 — CID 116938203
4-amino-4-(1,3-benzoxazol-6-yl)-3-methylbutanoic acid (PubChem CID 116938203) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 4-amino-4-(1,3-benzoxazol-6-yl)-3-methylbutanoic acid.
| Compound Name | 4-amino-4-(1,3-benzoxazol-6-yl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 116938203 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 4-amino-4-(1,3-benzoxazol-6-yl)-3-methylbutanoic acid |
| SMILES | CC(CC(=O)O)C(N)c1ccc2ncoc2c1 |
| InChI | InChI=1S/C12H14N2O3/c1-7(4-11(15)16)12(13)8-2-3-9-10(5-8)17-6-14-9/h2-3,5-7,12H,4,13H2,1H3,(H,15,16) |
| InChIKey | VZVSISCFWFRQOR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |