C9H10N2O2 — CID 82599704
2-amino-2-(1,3-benzoxazol-6-yl)ethanol (PubChem CID 82599704) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-amino-2-(1,3-benzoxazol-6-yl)ethanol.
| Compound Name | 2-amino-2-(1,3-benzoxazol-6-yl)ethanol |
|---|---|
| PubChem CID | 82599704 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 2-amino-2-(1,3-benzoxazol-6-yl)ethanol |
| SMILES | NC(CO)c1ccc2ncoc2c1 |
| InChI | InChI=1S/C9H10N2O2/c10-7(4-12)6-1-2-8-9(3-6)13-5-11-8/h1-3,5,7,12H,4,10H2 |
| InChIKey | UGWSXJOYFWGWCE-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |