C12H11N3O2S — CID 116966777
2-amino-2-[4-(1,3-benzoxazol-6-yl)-1,3-thiazol-2-yl]ethanol (PubChem CID 116966777) has the molecular formula C12H11N3O2S and a molecular weight of 261.31 g/mol. Its IUPAC name is 2-amino-2-[4-(1,3-benzoxazol-6-yl)-1,3-thiazol-2-yl]ethanol.
| Compound Name | 2-amino-2-[4-(1,3-benzoxazol-6-yl)-1,3-thiazol-2-yl]ethanol |
|---|---|
| PubChem CID | 116966777 |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 2-amino-2-[4-(1,3-benzoxazol-6-yl)-1,3-thiazol-2-yl]ethanol |
| SMILES | NC(CO)c1nc(-c2ccc3ncoc3c2)cs1 |
| InChI | InChI=1S/C12H11N3O2S/c13-8(4-16)12-15-10(5-18-12)7-1-2-9-11(3-7)17-6-14-9/h1-3,5-6,8,16H,4,13H2 |
| InChIKey | NJGIEYPPWOGDHM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |