C12H8N2O2S — CID 116867478
1-[4-(1,3-benzoxazol-6-yl)-1,3-thiazol-2-yl]ethanone (PubChem CID 116867478) has the molecular formula C12H8N2O2S and a molecular weight of 244.28 g/mol. Its IUPAC name is 1-[4-(1,3-benzoxazol-6-yl)-1,3-thiazol-2-yl]ethanone.
| Compound Name | 1-[4-(1,3-benzoxazol-6-yl)-1,3-thiazol-2-yl]ethanone |
|---|---|
| PubChem CID | 116867478 |
| Molecular Formula | C12H8N2O2S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 1-[4-(1,3-benzoxazol-6-yl)-1,3-thiazol-2-yl]ethanone |
| SMILES | CC(=O)c1nc(-c2ccc3ncoc3c2)cs1 |
| InChI | InChI=1S/C12H8N2O2S/c1-7(15)12-14-10(5-17-12)8-2-3-9-11(4-8)16-6-13-9/h2-6H,1H3 |
| InChIKey | ZTGODNNFFRDWLJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |