C13H11N3OS — CID 116867483
1-[4-(1-methylbenzimidazol-5-yl)-1,3-thiazol-2-yl]ethanone (PubChem CID 116867483) has the molecular formula C13H11N3OS and a molecular weight of 257.32 g/mol. Its IUPAC name is 1-[4-(1-methylbenzimidazol-5-yl)-1,3-thiazol-2-yl]ethanone.
| Compound Name | 1-[4-(1-methylbenzimidazol-5-yl)-1,3-thiazol-2-yl]ethanone |
|---|---|
| PubChem CID | 116867483 |
| Molecular Formula | C13H11N3OS |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 1-[4-(1-methylbenzimidazol-5-yl)-1,3-thiazol-2-yl]ethanone |
| SMILES | CC(=O)c1nc(-c2ccc3c(c2)ncn3C)cs1 |
| InChI | InChI=1S/C13H11N3OS/c1-8(17)13-15-11(6-18-13)9-3-4-12-10(5-9)14-7-16(12)2/h3-7H,1-2H3 |
| InChIKey | VCNBIBKPYXCRSL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |