C12H17N3O2 — CID 115120857
2-amino-3-[2-(1,3-benzoxazol-6-yl)ethylamino]propan-1-ol (PubChem CID 115120857) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 2-amino-3-[2-(1,3-benzoxazol-6-yl)ethylamino]propan-1-ol.
| Compound Name | 2-amino-3-[2-(1,3-benzoxazol-6-yl)ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 115120857 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 2-amino-3-[2-(1,3-benzoxazol-6-yl)ethylamino]propan-1-ol |
| SMILES | NC(CO)CNCCc1ccc2ncoc2c1 |
| InChI | InChI=1S/C12H17N3O2/c13-10(7-16)6-14-4-3-9-1-2-11-12(5-9)17-8-15-11/h1-2,5,8,10,14,16H,3-4,6-7,13H2 |
| InChIKey | XZASUCBFPYLLOB-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|