C12H17N3O — CID 115199329
1-N-(1,3-benzoxazol-6-ylmethyl)butane-1,3-diamine (PubChem CID 115199329) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 1-N-(1,3-benzoxazol-6-ylmethyl)butane-1,3-diamine.
| Compound Name | 1-N-(1,3-benzoxazol-6-ylmethyl)butane-1,3-diamine |
|---|---|
| PubChem CID | 115199329 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 1-N-(1,3-benzoxazol-6-ylmethyl)butane-1,3-diamine |
| SMILES | CC(N)CCNCc1ccc2ncoc2c1 |
| InChI | InChI=1S/C12H17N3O/c1-9(13)4-5-14-7-10-2-3-11-12(6-10)16-8-15-11/h2-3,6,8-9,14H,4-5,7,13H2,1H3 |
| InChIKey | NNJHLEXJMGCRKS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|