C10H11ClN2O — CID 115214866
N-(1,3-benzoxazol-6-ylmethyl)-2-chloroethanamine (PubChem CID 115214866) has the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. Its IUPAC name is N-(1,3-benzoxazol-6-ylmethyl)-2-chloroethanamine.
| Compound Name | N-(1,3-benzoxazol-6-ylmethyl)-2-chloroethanamine |
|---|---|
| PubChem CID | 115214866 |
| Molecular Formula | C10H11ClN2O |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | N-(1,3-benzoxazol-6-ylmethyl)-2-chloroethanamine |
| SMILES | ClCCNCc1ccc2ncoc2c1 |
| InChI | InChI=1S/C10H11ClN2O/c11-3-4-12-6-8-1-2-9-10(5-8)14-7-13-9/h1-2,5,7,12H,3-4,6H2 |
| InChIKey | PULZZQGFDCFGCG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|