C14H19N3O — CID 115210326
N-(1,3-benzoxazol-6-ylmethyl)-2-pyrrolidin-2-ylethanamine (PubChem CID 115210326) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is N-(1,3-benzoxazol-6-ylmethyl)-2-pyrrolidin-2-ylethanamine.
| Compound Name | N-(1,3-benzoxazol-6-ylmethyl)-2-pyrrolidin-2-ylethanamine |
|---|---|
| PubChem CID | 115210326 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | N-(1,3-benzoxazol-6-ylmethyl)-2-pyrrolidin-2-ylethanamine |
| SMILES | c1nc2ccc(CNCCC3CCCN3)cc2o1 |
| InChI | InChI=1S/C14H19N3O/c1-2-12(16-6-1)5-7-15-9-11-3-4-13-14(8-11)18-10-17-13/h3-4,8,10,12,15-16H,1-2,5-7,9H2 |
| InChIKey | QKDLHWJIWJRNHB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|