C13H17N3O — CID 115117420
1-N-(1,3-benzoxazol-6-ylmethyl)cyclopentane-1,2-diamine (PubChem CID 115117420) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 1-N-(1,3-benzoxazol-6-ylmethyl)cyclopentane-1,2-diamine.
| Compound Name | 1-N-(1,3-benzoxazol-6-ylmethyl)cyclopentane-1,2-diamine |
|---|---|
| PubChem CID | 115117420 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 1-N-(1,3-benzoxazol-6-ylmethyl)cyclopentane-1,2-diamine |
| SMILES | NC1CCCC1NCc1ccc2ncoc2c1 |
| InChI | InChI=1S/C13H17N3O/c14-10-2-1-3-11(10)15-7-9-4-5-12-13(6-9)17-8-16-12/h4-6,8,10-11,15H,1-3,7,14H2 |
| InChIKey | HEWUXMMSYHHKHO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |