C9H10N2O2 — CID 115229031
(1,3-benzoxazol-6-ylmethylamino)methanol (PubChem CID 115229031) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is (1,3-benzoxazol-6-ylmethylamino)methanol.
| Compound Name | (1,3-benzoxazol-6-ylmethylamino)methanol |
|---|---|
| PubChem CID | 115229031 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | (1,3-benzoxazol-6-ylmethylamino)methanol |
| SMILES | OCNCc1ccc2ncoc2c1 |
| InChI | InChI=1S/C9H10N2O2/c12-5-10-4-7-1-2-8-9(3-7)13-6-11-8/h1-3,6,10,12H,4-5H2 |
| InChIKey | VVVCXDHECWOWFQ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|