C12H14N2O3 — CID 115163001
N-(1,3-benzoxazol-6-ylmethyl)-4-hydroxybutanamide (PubChem CID 115163001) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is N-(1,3-benzoxazol-6-ylmethyl)-4-hydroxybutanamide.
| Compound Name | N-(1,3-benzoxazol-6-ylmethyl)-4-hydroxybutanamide |
|---|---|
| PubChem CID | 115163001 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | N-(1,3-benzoxazol-6-ylmethyl)-4-hydroxybutanamide |
| SMILES | O=C(CCCO)NCc1ccc2ncoc2c1 |
| InChI | InChI=1S/C12H14N2O3/c15-5-1-2-12(16)13-7-9-3-4-10-11(6-9)17-8-14-10/h3-4,6,8,15H,1-2,5,7H2,(H,13,16) |
| InChIKey | VWILSYPTCBQTFD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |