C15H13N3O2 — CID 110771768
2-(1,3-benzoxazol-6-yl)-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 110771768) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-6-yl)-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-(1,3-benzoxazol-6-yl)-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 110771768 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2-(1,3-benzoxazol-6-yl)-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | O=C(Cc1ccc2ncoc2c1)NCc1cccnc1 |
| InChI | InChI=1S/C15H13N3O2/c19-15(17-9-12-2-1-5-16-8-12)7-11-3-4-13-14(6-11)20-10-18-13/h1-6,8,10H,7,9H2,(H,17,19) |
| InChIKey | XYGVKEOZUCXXIV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |