C9H9ClN2O — CID 115263067
1-(1,3-benzoxazol-6-yl)-N-(chloromethyl)methanamine (PubChem CID 115263067) has the molecular formula C9H9ClN2O and a molecular weight of 196.64 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-6-yl)-N-(chloromethyl)methanamine.
| Compound Name | 1-(1,3-benzoxazol-6-yl)-N-(chloromethyl)methanamine |
|---|---|
| PubChem CID | 115263067 |
| Molecular Formula | C9H9ClN2O |
| Molecular Weight | 196.64 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 1-(1,3-benzoxazol-6-yl)-N-(chloromethyl)methanamine |
| SMILES | ClCNCc1ccc2ncoc2c1 |
| InChI | InChI=1S/C9H9ClN2O/c10-5-11-4-7-1-2-8-9(3-7)13-6-12-8/h1-3,6,11H,4-5H2 |
| InChIKey | DBQLSBYNSKFDII-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.64 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|