C14H18N2O3 — CID 115250335
2-[(1,3-benzoxazol-6-ylmethylamino)methyl]-3-methylbutanoic acid (PubChem CID 115250335) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-[(1,3-benzoxazol-6-ylmethylamino)methyl]-3-methylbutanoic acid.
| Compound Name | 2-[(1,3-benzoxazol-6-ylmethylamino)methyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 115250335 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 2-[(1,3-benzoxazol-6-ylmethylamino)methyl]-3-methylbutanoic acid |
| SMILES | CC(C)C(CNCc1ccc2ncoc2c1)C(=O)O |
| InChI | InChI=1S/C14H18N2O3/c1-9(2)11(14(17)18)7-15-6-10-3-4-12-13(5-10)19-8-16-12/h3-5,8-9,11,15H,6-7H2,1-2H3,(H,17,18) |
| InChIKey | ZTSAYCWKFRWPNY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |