4-(1,3-benzoxazol-6-yl)-2-methylbutanoic acid

C12H13NO3 — CID 116926938

IUPAC4-(1,3-benzoxazol-6-yl)-2-methylbutanoic acid
SMILESCC(CCc1ccc2ncoc2c1)C(=O)O
InChIInChI=1S/C12H13NO3/c1-8(12(14)15)2-3-9-4-5-10-11(6-9)16-7-13-10/h4-8H,2-3H2,1H3,(H,14,15)
InChIKeyJBTMNRJMRAUPEX-UHFFFAOYSA-N
MW219.24 g/mol
LogP2.48
Rot. Bonds4

About 4-(1,3-benzoxazol-6-yl)-2-methylbutanoic acid

4-(1,3-benzoxazol-6-yl)-2-methylbutanoic acid (PubChem CID 116926938) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-6-yl)-2-methylbutanoic acid.

Molecular Properties

Compound Name4-(1,3-benzoxazol-6-yl)-2-methylbutanoic acid
PubChem CID116926938
Molecular FormulaC12H13NO3
Molecular Weight219.24 g/mol
Exact Mass219.09
IUPAC Name4-(1,3-benzoxazol-6-yl)-2-methylbutanoic acid
SMILESCC(CCc1ccc2ncoc2c1)C(=O)O
InChIInChI=1S/C12H13NO3/c1-8(12(14)15)2-3-9-4-5-10-11(6-9)16-7-13-10/h4-8H,2-3H2,1H3,(H,14,15)
InChIKeyJBTMNRJMRAUPEX-UHFFFAOYSA-N
XLogP2.48
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.24
LogP ≤ 52.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(1,3-benzoxazol-6-yl)-2-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,3-benzoxazol-6-yl)-2-methylbutanoic acid?
The IUPAC name of 4-(1,3-benzoxazol-6-yl)-2-methylbutanoic acid (CID 116926938) is 4-(1,3-benzoxazol-6-yl)-2-methylbutanoic acid.
What is the SMILES notation for 4-(1,3-benzoxazol-6-yl)-2-methylbutanoic acid?
The canonical SMILES for 4-(1,3-benzoxazol-6-yl)-2-methylbutanoic acid is CC(CCc1ccc2ncoc2c1)C(=O)O.
What is the InChIKey of 4-(1,3-benzoxazol-6-yl)-2-methylbutanoic acid?
The InChIKey is JBTMNRJMRAUPEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3/c1-8(12(14)15)2-3-9-4-5-10-11(6-9)16-7-13-10/h4-8H,2-3H2,1H3,(H,14,15).
What are the key properties of 4-(1,3-benzoxazol-6-yl)-2-methylbutanoic acid?
4-(1,3-benzoxazol-6-yl)-2-methylbutanoic acid has a molecular weight of 219.24 g/mol, XLogP of 2.48, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzoxazol-6-yl)-2-methylbutanoic acid is sourced from PubChem (CID 116926938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).