4-(1,3-benzoxazol-6-yl)-2-methyl-4-oxobutanoic acid

C12H11NO4 — CID 116918442

IUPAC4-(1,3-benzoxazol-6-yl)-2-methyl-4-oxobutanoic acid
SMILESCC(CC(=O)c1ccc2ncoc2c1)C(=O)O
InChIInChI=1S/C12H11NO4/c1-7(12(15)16)4-10(14)8-2-3-9-11(5-8)17-6-13-9/h2-3,5-7H,4H2,1H3,(H,15,16)
InChIKeyXBZJXKMZUGFTBQ-UHFFFAOYSA-N
MW233.22 g/mol
LogP2.12
Rot. Bonds4

About 4-(1,3-benzoxazol-6-yl)-2-methyl-4-oxobutanoic acid

4-(1,3-benzoxazol-6-yl)-2-methyl-4-oxobutanoic acid (PubChem CID 116918442) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-6-yl)-2-methyl-4-oxobutanoic acid.

Molecular Properties

Compound Name4-(1,3-benzoxazol-6-yl)-2-methyl-4-oxobutanoic acid
PubChem CID116918442
Molecular FormulaC12H11NO4
Molecular Weight233.22 g/mol
Exact Mass233.07
IUPAC Name4-(1,3-benzoxazol-6-yl)-2-methyl-4-oxobutanoic acid
SMILESCC(CC(=O)c1ccc2ncoc2c1)C(=O)O
InChIInChI=1S/C12H11NO4/c1-7(12(15)16)4-10(14)8-2-3-9-11(5-8)17-6-13-9/h2-3,5-7H,4H2,1H3,(H,15,16)
InChIKeyXBZJXKMZUGFTBQ-UHFFFAOYSA-N
XLogP2.12
TPSA80.40 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.22
LogP ≤ 52.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-(1,3-benzoxazol-6-yl)-2-methyl-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,3-benzoxazol-6-yl)-2-methyl-4-oxobutanoic acid?
The IUPAC name of 4-(1,3-benzoxazol-6-yl)-2-methyl-4-oxobutanoic acid (CID 116918442) is 4-(1,3-benzoxazol-6-yl)-2-methyl-4-oxobutanoic acid.
What is the SMILES notation for 4-(1,3-benzoxazol-6-yl)-2-methyl-4-oxobutanoic acid?
The canonical SMILES for 4-(1,3-benzoxazol-6-yl)-2-methyl-4-oxobutanoic acid is CC(CC(=O)c1ccc2ncoc2c1)C(=O)O.
What is the InChIKey of 4-(1,3-benzoxazol-6-yl)-2-methyl-4-oxobutanoic acid?
The InChIKey is XBZJXKMZUGFTBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO4/c1-7(12(15)16)4-10(14)8-2-3-9-11(5-8)17-6-13-9/h2-3,5-7H,4H2,1H3,(H,15,16).
What are the key properties of 4-(1,3-benzoxazol-6-yl)-2-methyl-4-oxobutanoic acid?
4-(1,3-benzoxazol-6-yl)-2-methyl-4-oxobutanoic acid has a molecular weight of 233.22 g/mol, XLogP of 2.12, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzoxazol-6-yl)-2-methyl-4-oxobutanoic acid is sourced from PubChem (CID 116918442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).