C10H6F3NO5 — CID 138543085
1,3-benzoxazole-6-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 138543085) has the molecular formula C10H6F3NO5 and a molecular weight of 277.15 g/mol. Its IUPAC name is 1,3-benzoxazole-6-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 1,3-benzoxazole-6-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 138543085 |
| Molecular Formula | C10H6F3NO5 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 1,3-benzoxazole-6-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)c1ccc2ncoc2c1 |
| InChI | InChI=1S/C8H5NO3.C2HF3O2/c10-8(11)5-1-2-6-7(3-5)12-4-9-6;3-2(4,5)1(6)7/h1-4H,(H,10,11);(H,6,7) |
| InChIKey | ZMPARKHVCGAAMV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |