C8H6N2O3 — CID 115170663
1,3-benzoxazol-6-ylcarbamic acid (PubChem CID 115170663) has the molecular formula C8H6N2O3 and a molecular weight of 178.15 g/mol. Its IUPAC name is 1,3-benzoxazol-6-ylcarbamic acid.
| Compound Name | 1,3-benzoxazol-6-ylcarbamic acid |
|---|---|
| PubChem CID | 115170663 |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 1,3-benzoxazol-6-ylcarbamic acid |
| SMILES | O=C(O)Nc1ccc2ncoc2c1 |
| InChI | InChI=1S/C8H6N2O3/c11-8(12)10-5-1-2-6-7(3-5)13-4-9-6/h1-4,10H,(H,11,12) |
| InChIKey | UPNWUUKFOGBMDZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |