C9H5N3O2 — CID 115171898
N-(1,3-benzoxazol-6-yl)-1-cyanoformamide (PubChem CID 115171898) has the molecular formula C9H5N3O2 and a molecular weight of 187.16 g/mol. Its IUPAC name is N-(1,3-benzoxazol-6-yl)-1-cyanoformamide.
| Compound Name | N-(1,3-benzoxazol-6-yl)-1-cyanoformamide |
|---|---|
| PubChem CID | 115171898 |
| Molecular Formula | C9H5N3O2 |
| Molecular Weight | 187.16 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | N-(1,3-benzoxazol-6-yl)-1-cyanoformamide |
| SMILES | N#CC(=O)Nc1ccc2ncoc2c1 |
| InChI | InChI=1S/C9H5N3O2/c10-4-9(13)12-6-1-2-7-8(3-6)14-5-11-7/h1-3,5H,(H,12,13) |
| InChIKey | FZPNJZSGPLJZBP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.16 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|