C11H13N3O2 — CID 110748641
1-(1,3-benzoxazol-6-yl)-3-propylurea (PubChem CID 110748641) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-6-yl)-3-propylurea.
| Compound Name | 1-(1,3-benzoxazol-6-yl)-3-propylurea |
|---|---|
| PubChem CID | 110748641 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 1-(1,3-benzoxazol-6-yl)-3-propylurea |
| SMILES | CCCNC(=O)Nc1ccc2ncoc2c1 |
| InChI | InChI=1S/C11H13N3O2/c1-2-5-12-11(15)14-8-3-4-9-10(6-8)16-7-13-9/h3-4,6-7H,2,5H2,1H3,(H2,12,14,15) |
| InChIKey | PFLICUUINVQXCC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |