methyl 4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoate

C12H12N2O4 — CID 110728836

IUPACmethyl 4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoate
SMILESCOC(=O)CCC(=O)Nc1ccc2ncoc2c1
InChIInChI=1S/C12H12N2O4/c1-17-12(16)5-4-11(15)14-8-2-3-9-10(6-8)18-7-13-9/h2-3,6-7H,4-5H2,1H3,(H,14,15)
InChIKeyYTPNEJBZZQFOCV-UHFFFAOYSA-N
MW248.24 g/mol
LogP1.72
Rot. Bonds4

About methyl 4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoate

methyl 4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoate (PubChem CID 110728836) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is methyl 4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoate.

Molecular Properties

Compound Namemethyl 4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoate
PubChem CID110728836
Molecular FormulaC12H12N2O4
Molecular Weight248.24 g/mol
Exact Mass248.08
IUPAC Namemethyl 4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoate
SMILESCOC(=O)CCC(=O)Nc1ccc2ncoc2c1
InChIInChI=1S/C12H12N2O4/c1-17-12(16)5-4-11(15)14-8-2-3-9-10(6-8)18-7-13-9/h2-3,6-7H,4-5H2,1H3,(H,14,15)
InChIKeyYTPNEJBZZQFOCV-UHFFFAOYSA-N
XLogP1.72
TPSA81.43 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.24
LogP ≤ 51.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoate?
The IUPAC name of methyl 4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoate (CID 110728836) is methyl 4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoate.
What is the SMILES notation for methyl 4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoate?
The canonical SMILES for methyl 4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoate is COC(=O)CCC(=O)Nc1ccc2ncoc2c1.
What is the InChIKey of methyl 4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoate?
The InChIKey is YTPNEJBZZQFOCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O4/c1-17-12(16)5-4-11(15)14-8-2-3-9-10(6-8)18-7-13-9/h2-3,6-7H,4-5H2,1H3,(H,14,15).
What are the key properties of methyl 4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoate?
methyl 4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoate has a molecular weight of 248.24 g/mol, XLogP of 1.72, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoate is sourced from PubChem (CID 110728836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).