2-amino-4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoic acid

C11H11N3O4 — CID 115180959

IUPAC2-amino-4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoic acid
SMILESNC(CC(=O)Nc1ccc2ncoc2c1)C(=O)O
InChIInChI=1S/C11H11N3O4/c12-7(11(16)17)4-10(15)14-6-1-2-8-9(3-6)18-5-13-8/h1-3,5,7H,4,12H2,(H,14,15)(H,16,17)
InChIKeyBQEMYTDMXYNJJZ-UHFFFAOYSA-N
MW249.23 g/mol
LogP0.57
Rot. Bonds4

About 2-amino-4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoic acid

2-amino-4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoic acid (PubChem CID 115180959) has the molecular formula C11H11N3O4 and a molecular weight of 249.23 g/mol. Its IUPAC name is 2-amino-4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoic acid.

Molecular Properties

Compound Name2-amino-4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoic acid
PubChem CID115180959
Molecular FormulaC11H11N3O4
Molecular Weight249.23 g/mol
Exact Mass249.07
IUPAC Name2-amino-4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoic acid
SMILESNC(CC(=O)Nc1ccc2ncoc2c1)C(=O)O
InChIInChI=1S/C11H11N3O4/c12-7(11(16)17)4-10(15)14-6-1-2-8-9(3-6)18-5-13-8/h1-3,5,7H,4,12H2,(H,14,15)(H,16,17)
InChIKeyBQEMYTDMXYNJJZ-UHFFFAOYSA-N
XLogP0.57
TPSA118.45 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.23
LogP ≤ 50.57
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-amino-4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoic acid?
The IUPAC name of 2-amino-4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoic acid (CID 115180959) is 2-amino-4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoic acid.
What is the SMILES notation for 2-amino-4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoic acid?
The canonical SMILES for 2-amino-4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoic acid is NC(CC(=O)Nc1ccc2ncoc2c1)C(=O)O.
What is the InChIKey of 2-amino-4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoic acid?
The InChIKey is BQEMYTDMXYNJJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O4/c12-7(11(16)17)4-10(15)14-6-1-2-8-9(3-6)18-5-13-8/h1-3,5,7H,4,12H2,(H,14,15)(H,16,17).
What are the key properties of 2-amino-4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoic acid?
2-amino-4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoic acid has a molecular weight of 249.23 g/mol, XLogP of 0.57, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoic acid is sourced from PubChem (CID 115180959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).