C11H11N3O4 — CID 115180959
2-amino-4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoic acid (PubChem CID 115180959) has the molecular formula C11H11N3O4 and a molecular weight of 249.23 g/mol. Its IUPAC name is 2-amino-4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoic acid.
| Compound Name | 2-amino-4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 115180959 |
| Molecular Formula | C11H11N3O4 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2-amino-4-(1,3-benzoxazol-6-ylamino)-4-oxobutanoic acid |
| SMILES | NC(CC(=O)Nc1ccc2ncoc2c1)C(=O)O |
| InChI | InChI=1S/C11H11N3O4/c12-7(11(16)17)4-10(15)14-6-1-2-8-9(3-6)18-5-13-8/h1-3,5,7H,4,12H2,(H,14,15)(H,16,17) |
| InChIKey | BQEMYTDMXYNJJZ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |