C15H12N2O2 — CID 110728668
N-(1,3-benzoxazol-5-yl)-2-phenylacetamide (PubChem CID 110728668) has the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. Its IUPAC name is N-(1,3-benzoxazol-5-yl)-2-phenylacetamide.
| Compound Name | N-(1,3-benzoxazol-5-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 110728668 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | N-(1,3-benzoxazol-5-yl)-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)Nc1ccc2ocnc2c1 |
| InChI | InChI=1S/C15H12N2O2/c18-15(8-11-4-2-1-3-5-11)17-12-6-7-14-13(9-12)16-10-19-14/h1-7,9-10H,8H2,(H,17,18) |
| InChIKey | HPQFRTOWQBDFMV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |